C12H24O12 — CID 67600990
(2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;cyclohexane-1,2,3,4,5,6-hexol (PubChem CID 67600990) has the molecular formula C12H24O12 and a molecular weight of 360.31 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;cyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;cyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 67600990 |
| Molecular Formula | C12H24O12 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;cyclohexane-1,2,3,4,5,6-hexol |
| SMILES | OC1C(O)C(O)C(O)C(O)C1O.OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/2C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3;7-1-2(8)4(10)6(12)5(11)3(1)9/h3-5,7-11H,1-2H2;1-12H/t3-,4-,5+,6-;/m1./s1 |
| InChIKey | WXMQPXGDFVELRF-PVCLPBLSSA-N |
| XLogP | -7.05 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | -7.05 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |