C12H26O12 — CID 70436487
(2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 70436487) has the molecular formula C12H26O12 and a molecular weight of 362.33 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 70436487 |
| Molecular Formula | C12H26O12 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6.C6H14O6/c7-1-3-4(9)5(10)6(11,2-8)12-3;7-1-3(9)5(11)6(12)4(10)2-8/h3-5,7-11H,1-2H2;3-12H,1-2H2/t3-,4-,5+,6-;3-,4+,5-,6-/m11/s1 |
| InChIKey | WNUXDPPYEDLPEW-DIHALTFOSA-N |
| XLogP | -6.81 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -6.81 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |