C6H13O6P — CID 141114206
(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-phosphanyloxane-2,3,4,5-tetrol (PubChem CID 141114206) has the molecular formula C6H13O6P and a molecular weight of 212.14 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-phosphanyloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-phosphanyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 141114206 |
| Molecular Formula | C6H13O6P |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-phosphanyloxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@](O)(P)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13O6P/c7-1-2-3(8)4(9)5(10)6(11,13)12-2/h2-5,7-11H,1,13H2/t2-,3+,4+,5-,6+/m1/s1 |
| InChIKey | IDXOBKJPWLSGIJ-PHYPRBDBSA-N |
| XLogP | -3.02 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|