C6H14N2O5 — CID 171922004
(3R,4S,5S,6R)-2,2-diamino-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 171922004) has the molecular formula C6H14N2O5 and a molecular weight of 194.19 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2,2-diamino-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2,2-diamino-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 171922004 |
| Molecular Formula | C6H14N2O5 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (3R,4S,5S,6R)-2,2-diamino-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NC1(N)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14N2O5/c7-6(8)5(12)4(11)3(10)2(1-9)13-6/h2-5,9-12H,1,7-8H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | PLYYDUXMWBZNGB-SQOUGZDYSA-N |
| XLogP | -3.97 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|