C8H18O6 — CID 162165595
6-(hydroxymethyl)-2-methyloxane-2,3,4,5-tetrol;methane (PubChem CID 162165595) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2-methyloxane-2,3,4,5-tetrol;methane.
| Compound Name | 6-(hydroxymethyl)-2-methyloxane-2,3,4,5-tetrol;methane |
|---|---|
| PubChem CID | 162165595 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 6-(hydroxymethyl)-2-methyloxane-2,3,4,5-tetrol;methane |
| SMILES | C.CC1(O)OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14O6.CH4/c1-7(12)6(11)5(10)4(9)3(2-8)13-7;/h3-6,8-12H,2H2,1H3;1H4 |
| InChIKey | ZNBUKMOKSFCHMA-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |