C8H14O7 — CID 140998666
1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone (PubChem CID 140998666) has the molecular formula C8H14O7 and a molecular weight of 222.19 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 140998666 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O7/c1-3(10)8(14)7(13)6(12)5(11)4(2-9)15-8/h4-7,9,11-14H,2H2,1H3/t4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | SCBJZDPIRGXHFV-DWOUCZDBSA-N |
| XLogP | -3.26 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |