C8H14O6S — CID 141355498
1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-2-yl]ethanone (PubChem CID 141355498) has the molecular formula C8H14O6S and a molecular weight of 238.26 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 141355498 |
| Molecular Formula | C8H14O6S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-2-yl]ethanone |
| SMILES | CC(=O)[C@]1(S)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O6S/c1-3(10)8(15)7(13)6(12)5(11)4(2-9)14-8/h4-7,9,11-13,15H,2H2,1H3/t4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | QXKRKXQDVDYBKO-DWOUCZDBSA-N |
| XLogP | -2.32 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|