C9H16O8 — CID 67642671
[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl] acetate (PubChem CID 67642671) has the molecular formula C9H16O8 and a molecular weight of 252.22 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl] acetate |
|---|---|
| PubChem CID | 67642671 |
| Molecular Formula | C9H16O8 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl] acetate |
| SMILES | CO[C@]1(OC(C)=O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O8/c1-4(11)16-9(15-2)8(14)7(13)6(12)5(3-10)17-9/h5-8,10,12-14H,3H2,1-2H3/t5-,6+,7+,8-,9-/m1/s1 |
| InChIKey | VYJMTIGNOOWMHL-QMGXLNLGSA-N |
| XLogP | -2.68 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|