C8H13ClO6 — CID 142625830
[(2S,4R,5S,6R)-2-chloro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate (PubChem CID 142625830) has the molecular formula C8H13ClO6 and a molecular weight of 240.64 g/mol. Its IUPAC name is [(2S,4R,5S,6R)-2-chloro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate.
| Compound Name | [(2S,4R,5S,6R)-2-chloro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 142625830 |
| Molecular Formula | C8H13ClO6 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | [(2S,4R,5S,6R)-2-chloro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate |
| SMILES | CC(=O)O[C@]1(Cl)C[C@@H](O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H13ClO6/c1-4(11)14-8(9)2-5(12)7(13)6(3-10)15-8/h5-7,10,12-13H,2-3H2,1H3/t5-,6-,7+,8-/m1/s1 |
| InChIKey | JANGKMLVKZKXMM-OOJXKGFFSA-N |
| XLogP | -1.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|