About [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate
[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate (PubChem CID 90165528) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate.
Analyze [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate?
The IUPAC name of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate (CID 90165528) is [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate.
What is the SMILES notation for [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate?
The canonical SMILES for [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate is CC(=O)OC1C[C@H](O)[C@@H](CO)O1.
What is the InChIKey of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate?
The InChIKey is ZCZKWLPWAPXYDS-GFCOJPQKSA-N. The full InChI is InChI=1S/C7H12O5/c1-4(9)11-7-2-5(10)6(3-8)12-7/h5-8,10H,2-3H2,1H3/t5-,6+,7?/m0/s1.
What are the key properties of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate?
[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate has a molecular weight of 176.17 g/mol, XLogP of -0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] acetate is sourced from PubChem (CID 90165528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).