C5H17N2O7P — CID 11543311
diazanium;[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate (PubChem CID 11543311) has the molecular formula C5H17N2O7P and a molecular weight of 248.17 g/mol. Its IUPAC name is diazanium;[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate.
| Compound Name | diazanium;[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
|---|---|
| PubChem CID | 11543311 |
| Molecular Formula | C5H17N2O7P |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | diazanium;[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
| SMILES | O=P([O-])([O-])OC1CC(O)C(CO)O1.[NH4+].[NH4+] |
| InChI | InChI=1S/C5H11O7P.2H3N/c6-2-4-3(7)1-5(11-4)12-13(8,9)10;;/h3-7H,1-2H2,(H2,8,9,10);2*1H3 |
| InChIKey | YFKPWEIXEGYFFN-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 195.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|