About [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite
[(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite (PubChem CID 69004119) has the molecular formula C5H9ClO4
and a molecular weight of 168.58 g/mol. Its IUPAC name is [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite.
Analyze [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite?
The IUPAC name of [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite (CID 69004119) is [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite.
What is the SMILES notation for [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite?
The canonical SMILES for [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite is OC[C@@H]1OC(OCl)C[C@H]1O.
What is the InChIKey of [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite?
The InChIKey is WZUXPMCLRUQHPK-OVEKKEMJSA-N. The full InChI is InChI=1S/C5H9ClO4/c6-10-5-1-3(8)4(2-7)9-5/h3-5,7-8H,1-2H2/t3-,4+,5?/m1/s1.
What are the key properties of [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite?
[(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite has a molecular weight of 168.58 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] hypochlorite is sourced from PubChem (CID 69004119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).