C5H9ClO3 — CID 67099694
(2R,3S,5R)-5-chloro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 67099694) has the molecular formula C5H9ClO3 and a molecular weight of 152.58 g/mol. Its IUPAC name is (2R,3S,5R)-5-chloro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-chloro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 67099694 |
| Molecular Formula | C5H9ClO3 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | (2R,3S,5R)-5-chloro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@H](Cl)C[C@@H]1O |
| InChI | InChI=1S/C5H9ClO3/c6-5-1-3(8)4(2-7)9-5/h3-5,7-8H,1-2H2/t3-,4+,5-/m0/s1 |
| InChIKey | VZTAMBBQSMFVAF-LMVFSUKVSA-N |
| XLogP | -0.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|