C6H12O3 — CID 59795765
(2S,3R,5R)-2-(hydroxymethyl)-5-methyloxolan-3-ol (PubChem CID 59795765) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2S,3R,5R)-2-(hydroxymethyl)-5-methyloxolan-3-ol.
| Compound Name | (2S,3R,5R)-2-(hydroxymethyl)-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 59795765 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (2S,3R,5R)-2-(hydroxymethyl)-5-methyloxolan-3-ol |
| SMILES | C[C@@H]1C[C@@H](O)[C@H](CO)O1 |
| InChI | InChI=1S/C6H12O3/c1-4-2-5(8)6(3-7)9-4/h4-8H,2-3H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | VYMGPBXXQAUPSO-PBXRRBTRSA-N |
| XLogP | -0.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |