C6H11FO2 — CID 58758245
(3S,5S)-2-(fluoromethyl)-5-methyloxolan-3-ol (PubChem CID 58758245) has the molecular formula C6H11FO2 and a molecular weight of 134.15 g/mol. Its IUPAC name is (3S,5S)-2-(fluoromethyl)-5-methyloxolan-3-ol.
| Compound Name | (3S,5S)-2-(fluoromethyl)-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58758245 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (3S,5S)-2-(fluoromethyl)-5-methyloxolan-3-ol |
| SMILES | C[C@H]1C[C@H](O)C(CF)O1 |
| InChI | InChI=1S/C6H11FO2/c1-4-2-5(8)6(3-7)9-4/h4-6,8H,2-3H2,1H3/t4-,5-,6?/m0/s1 |
| InChIKey | HSSIRXKISCZMSY-HVYQYDHPSA-N |
| XLogP | 0.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |