About [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium
[(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium (PubChem CID 102138015) has the molecular formula C9H20NO2+
and a molecular weight of 174.26 g/mol. Its IUPAC name is [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium.
Molecular Properties
| Compound Name | [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium |
| PubChem CID | 102138015 |
| Molecular Formula | C9H20NO2+ |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium |
| SMILES | C[C@H]1C[C@H](O)[C@H](C[N+](C)(C)C)O1 |
| InChI | InChI=1S/C9H20NO2/c1-7-5-8(11)9(12-7)6-10(2,3)4/h7-9,11H,5-6H2,1-4H3/q+1/t7-,8-,9-/m0/s1 |
| InChIKey | BFHBGSHLIWJYIK-CIUDSAMLSA-N |
| XLogP | 0.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium?
The IUPAC name of [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium (CID 102138015) is [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium.
What is the SMILES notation for [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium?
The canonical SMILES for [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium is C[C@H]1C[C@H](O)[C@H](C[N+](C)(C)C)O1.
What is the InChIKey of [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium?
The InChIKey is BFHBGSHLIWJYIK-CIUDSAMLSA-N. The full InChI is InChI=1S/C9H20NO2/c1-7-5-8(11)9(12-7)6-10(2,3)4/h7-9,11H,5-6H2,1-4H3/q+1/t7-,8-,9-/m0/s1.
What are the key properties of [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium?
[(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium has a molecular weight of 174.26 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S,5S)-3-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium is sourced from PubChem (CID 102138015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).