C9H20NO2+ — CID 9308
[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium (PubChem CID 9308) has the molecular formula C9H20NO2+ and a molecular weight of 174.26 g/mol. Its IUPAC name is [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium.
| Compound Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 9308 |
| Molecular Formula | C9H20NO2+ |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium |
| SMILES | C[C@@H]1O[C@H](C[N+](C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C9H20NO2/c1-7-9(11)5-8(12-7)6-10(2,3)4/h7-9,11H,5-6H2,1-4H3/q+1/t7-,8-,9+/m0/s1 |
| InChIKey | UQOFGTXDASPNLL-XHNCKOQMSA-N |
| XLogP | 0.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|