C16H24INO3 — CID 10668987
[(2R,4R,5S)-4-benzoyloxy-5-methyloxolan-2-yl]methyl-trimethylazanium iodide (PubChem CID 10668987) has the molecular formula C16H24INO3 and a molecular weight of 405.28 g/mol. Its IUPAC name is [(2R,4R,5S)-4-benzoyloxy-5-methyloxolan-2-yl]methyl-trimethylazanium iodide.
| Compound Name | [(2R,4R,5S)-4-benzoyloxy-5-methyloxolan-2-yl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 10668987 |
| Molecular Formula | C16H24INO3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [(2R,4R,5S)-4-benzoyloxy-5-methyloxolan-2-yl]methyl-trimethylazanium iodide |
| SMILES | C[C@@H]1O[C@@H](C[N+](C)(C)C)C[C@H]1OC(=O)c1ccccc1.[I-] |
| InChI | InChI=1S/C16H24NO3.HI/c1-12-15(10-14(19-12)11-17(2,3)4)20-16(18)13-8-6-5-7-9-13;/h5-9,12,14-15H,10-11H2,1-4H3;1H/q+1;/p-1/t12-,14+,15+;/m0./s1 |
| InChIKey | KTWVPGYWACBZEU-SQFLUBDYSA-M |
| XLogP | -0.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|