C20H22O5 — CID 57333728
[(2S,3S,5R)-6-hydroxy-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 57333728) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2S,3S,5R)-6-hydroxy-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,5R)-6-hydroxy-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 57333728 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [(2S,3S,5R)-6-hydroxy-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | C[C@@H]1OC(O)[C@H](OCc2ccccc2)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O5/c1-14-17(25-19(21)16-10-6-3-7-11-16)12-18(20(22)24-14)23-13-15-8-4-2-5-9-15/h2-11,14,17-18,20,22H,12-13H2,1H3/t14-,17-,18+,20?/m0/s1 |
| InChIKey | RQCOTISTEUBRCC-MJRXPKLRSA-N |
| XLogP | 2.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |