C22H26O5 — CID 11132398
[(3R,5R,6R)-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate (PubChem CID 11132398) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(3R,5R,6R)-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate.
| Compound Name | [(3R,5R,6R)-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 11132398 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [(3R,5R,6R)-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](C)[C@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O5/c1-16-20(24-14-18-9-5-3-6-10-18)13-21(22(26-16)27-17(2)23)25-15-19-11-7-4-8-12-19/h3-12,16,20-22H,13-15H2,1-2H3/t16-,20-,21-,22?/m1/s1 |
| InChIKey | AEPLTIPXMYJFQH-XURXJGIDSA-N |
| XLogP | 3.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |