C21H24O4S — CID 101018955
[(3R,5S,6R)-6-methyl-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] acetate (PubChem CID 101018955) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is [(3R,5S,6R)-6-methyl-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(3R,5S,6R)-6-methyl-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101018955 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [(3R,5S,6R)-6-methyl-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](OCc2ccccc2)[C@@H](C)OC1Sc1ccccc1 |
| InChI | InChI=1S/C21H24O4S/c1-15-19(23-14-17-9-5-3-6-10-17)13-20(25-16(2)22)21(24-15)26-18-11-7-4-8-12-18/h3-12,15,19-21H,13-14H2,1-2H3/t15-,19+,20-,21?/m1/s1 |
| InChIKey | QHRQFHGDABOPMI-YVSPWKMDSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |