C35H36O6S — CID 11570600
[(2R,3S,4R,5S,6R)-4,5,6-tris(phenylmethoxy)-2-phenylsulfanyloxepan-3-yl] acetate (PubChem CID 11570600) has the molecular formula C35H36O6S and a molecular weight of 584.73 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-4,5,6-tris(phenylmethoxy)-2-phenylsulfanyloxepan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-4,5,6-tris(phenylmethoxy)-2-phenylsulfanyloxepan-3-yl] acetate |
|---|---|
| PubChem CID | 11570600 |
| Molecular Formula | C35H36O6S |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-4,5,6-tris(phenylmethoxy)-2-phenylsulfanyloxepan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)CO[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C35H36O6S/c1-26(36)41-34-33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(37-22-27-14-6-2-7-15-27)25-40-35(34)42-30-20-12-5-13-21-30/h2-21,31-35H,22-25H2,1H3/t31-,32+,33-,34+,35-/m1/s1 |
| InChIKey | ZCPDNMMGZUDLHX-XXSAGVDUSA-N |
| XLogP | 6.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |