C21H23N3O5S — CID 101247249
[(2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] acetate (PubChem CID 101247249) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 101247249 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](N=[N+]=[N-])[C@@H](Sc2ccccc2)O[C@H](CO)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-14(26)28-20-18(23-24-22)21(30-16-10-6-3-7-11-16)29-17(12-25)19(20)27-13-15-8-4-2-5-9-15/h2-11,17-21,25H,12-13H2,1H3/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | WUFWKPNBJMHBGV-PFAUGDHASA-N |
| XLogP | 3.69 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|