C41H44N4O7S — CID 102168077
[(2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] 2-[9H-fluoren-9-ylmethoxycarbonyl(pentan-3-yl)amino]acetate (PubChem CID 102168077) has the molecular formula C41H44N4O7S and a molecular weight of 736.89 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] 2-[9H-fluoren-9-ylmethoxycarbonyl(pentan-3-yl)amino]acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] 2-[9H-fluoren-9-ylmethoxycarbonyl(pentan-3-yl)amino]acetate |
|---|---|
| PubChem CID | 102168077 |
| Molecular Formula | C41H44N4O7S |
| Molecular Weight | 736.89 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-3-phenylmethoxy-6-phenylsulfanyloxan-4-yl] 2-[9H-fluoren-9-ylmethoxycarbonyl(pentan-3-yl)amino]acetate |
| SMILES | CCC(CC)N(CC(=O)O[C@@H]1[C@@H](N=[N+]=[N-])[C@@H](Sc2ccccc2)O[C@H](CO)[C@@H]1OCc1ccccc1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H44N4O7S/c1-3-28(4-2)45(41(48)50-26-34-32-21-13-11-19-30(32)31-20-12-14-22-33(31)34)23-36(47)52-39-37(43-44-42)40(53-29-17-9-6-10-18-29)51-35(24-46)38(39)49-25-27-15-7-5-8-16-27/h5-22,28,34-35,37-40,46H,3-4,23-26H2,1-2H3/t35-,37-,38+,39-,40-/m1/s1 |
| InChIKey | GXECIOHQBJHYDY-HRSAFRLBSA-N |
| XLogP | 8.11 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.89 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|