C22H29N3O4SSi — CID 11236514
(2S,3R,4R,5R,6R)-3-azido-5-phenylmethoxy-2-phenylsulfanyl-6-(trimethylsilyloxymethyl)oxan-4-ol (PubChem CID 11236514) has the molecular formula C22H29N3O4SSi and a molecular weight of 459.64 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-3-azido-5-phenylmethoxy-2-phenylsulfanyl-6-(trimethylsilyloxymethyl)oxan-4-ol.
| Compound Name | (2S,3R,4R,5R,6R)-3-azido-5-phenylmethoxy-2-phenylsulfanyl-6-(trimethylsilyloxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 11236514 |
| Molecular Formula | C22H29N3O4SSi |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2S,3R,4R,5R,6R)-3-azido-5-phenylmethoxy-2-phenylsulfanyl-6-(trimethylsilyloxymethyl)oxan-4-ol |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O4SSi/c1-31(2,3)28-15-18-21(27-14-16-10-6-4-7-11-16)20(26)19(24-25-23)22(29-18)30-17-12-8-5-9-13-17/h4-13,18-22,26H,14-15H2,1-3H3/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | DPZZNUDBFPWSRX-YXIAPDDASA-N |
| XLogP | 4.98 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|