C12H14N6O3S — CID 54577685
(2R,3S,4R,5S,6R)-4,5-diazido-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol (PubChem CID 54577685) has the molecular formula C12H14N6O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-4,5-diazido-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol.
| Compound Name | (2R,3S,4R,5S,6R)-4,5-diazido-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 54577685 |
| Molecular Formula | C12H14N6O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (2R,3S,4R,5S,6R)-4,5-diazido-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](O)[C@@H](CO)O[C@H](Sc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H14N6O3S/c13-17-15-9-10(16-18-14)12(21-8(6-19)11(9)20)22-7-4-2-1-3-5-7/h1-5,8-12,19-20H,6H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | QIPNSESTVDJWIV-RMPHRYRLSA-N |
| XLogP | 2.21 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|