C20H31N3O4S — CID 173487436
(3S,6S)-5-azido-4-butoxy-2-(butoxymethyl)-6-phenylsulfanyloxan-3-ol (PubChem CID 173487436) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is (3S,6S)-5-azido-4-butoxy-2-(butoxymethyl)-6-phenylsulfanyloxan-3-ol.
| Compound Name | (3S,6S)-5-azido-4-butoxy-2-(butoxymethyl)-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 173487436 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (3S,6S)-5-azido-4-butoxy-2-(butoxymethyl)-6-phenylsulfanyloxan-3-ol |
| SMILES | CCCCOCC1O[C@@H](Sc2ccccc2)C(N=[N+]=[N-])C(OCCCC)[C@@H]1O |
| InChI | InChI=1S/C20H31N3O4S/c1-3-5-12-25-14-16-18(24)19(26-13-6-4-2)17(22-23-21)20(27-16)28-15-10-8-7-9-11-15/h7-11,16-20,24H,3-6,12-14H2,1-2H3/t16?,17?,18-,19?,20+/m1/s1 |
| InChIKey | XMDFHVGKWFNDGY-WKRFXVHVSA-N |
| XLogP | 4.55 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|