C14H27N3O5 — CID 173485082
(2R,5S)-5-azido-4-butoxy-6-(butoxymethyl)oxane-2,3-diol (PubChem CID 173485082) has the molecular formula C14H27N3O5 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2R,5S)-5-azido-4-butoxy-6-(butoxymethyl)oxane-2,3-diol.
| Compound Name | (2R,5S)-5-azido-4-butoxy-6-(butoxymethyl)oxane-2,3-diol |
|---|---|
| PubChem CID | 173485082 |
| Molecular Formula | C14H27N3O5 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2R,5S)-5-azido-4-butoxy-6-(butoxymethyl)oxane-2,3-diol |
| SMILES | CCCCOCC1O[C@@H](O)C(O)C(OCCCC)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H27N3O5/c1-3-5-7-20-9-10-11(16-17-15)13(21-8-6-4-2)12(18)14(19)22-10/h10-14,18-19H,3-9H2,1-2H3/t10?,11-,12?,13?,14+/m0/s1 |
| InChIKey | OJRQYSIHHPCUOO-ARDLJMPDSA-N |
| XLogP | 1.75 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|