C22H27N3O5 — CID 174746498
(2R,3R,4S,5S,6S)-5-azido-4-(2-phenylethoxy)-6-(2-phenylethoxymethyl)oxane-2,3-diol (PubChem CID 174746498) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-5-azido-4-(2-phenylethoxy)-6-(2-phenylethoxymethyl)oxane-2,3-diol.
| Compound Name | (2R,3R,4S,5S,6S)-5-azido-4-(2-phenylethoxy)-6-(2-phenylethoxymethyl)oxane-2,3-diol |
|---|---|
| PubChem CID | 174746498 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2R,3R,4S,5S,6S)-5-azido-4-(2-phenylethoxy)-6-(2-phenylethoxymethyl)oxane-2,3-diol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](OCCc2ccccc2)[C@@H](O)[C@H](O)O[C@@H]1COCCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O5/c23-25-24-19-18(15-28-13-11-16-7-3-1-4-8-16)30-22(27)20(26)21(19)29-14-12-17-9-5-2-6-10-17/h1-10,18-22,26-27H,11-15H2/t18-,19+,20-,21+,22-/m1/s1 |
| InChIKey | RSBDWSFLLRHJOJ-OQEHDIDLSA-N |
| XLogP | 2.63 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|