C31H37N3O5 — CID 118332921
(4S,5R)-6-[2-[4-(2-azidoethyl)phenyl]ethoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol (PubChem CID 118332921) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is (4S,5R)-6-[2-[4-(2-azidoethyl)phenyl]ethoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (4S,5R)-6-[2-[4-(2-azidoethyl)phenyl]ethoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 118332921 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | (4S,5R)-6-[2-[4-(2-azidoethyl)phenyl]ethoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
| SMILES | C[C@@H]1C(OCc2ccccc2)C(O)OC(COCCc2ccc(CCN=[N+]=[N-])cc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H37N3O5/c1-23-29(37-20-26-8-4-2-5-9-26)28(39-31(35)30(23)38-21-27-10-6-3-7-11-27)22-36-19-17-25-14-12-24(13-15-25)16-18-33-34-32/h2-15,23,28-31,35H,16-22H2,1H3/t23-,28?,29+,30?,31?/m0/s1 |
| InChIKey | JIUKDVQVUBZZFD-UDWDGGTLSA-N |
| XLogP | 5.62 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|