C32H35F3N4O5 — CID 118332926
[(2S,4S,5R)-6-(3-azidopropoxymethyl)-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 118332926) has the molecular formula C32H35F3N4O5 and a molecular weight of 612.65 g/mol. Its IUPAC name is [(2S,4S,5R)-6-(3-azidopropoxymethyl)-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(2S,4S,5R)-6-(3-azidopropoxymethyl)-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 118332926 |
| Molecular Formula | C32H35F3N4O5 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | [(2S,4S,5R)-6-(3-azidopropoxymethyl)-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | C[C@@H]1C(OCc2ccccc2)[C@H](O/C(=N/c2ccccc2)C(F)(F)F)OC(COCCCN=[N+]=[N-])[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H35F3N4O5/c1-23-28(41-20-24-12-5-2-6-13-24)27(22-40-19-11-18-37-39-36)43-30(29(23)42-21-25-14-7-3-8-15-25)44-31(32(33,34)35)38-26-16-9-4-10-17-26/h2-10,12-17,23,27-30H,11,18-22H2,1H3/b38-31+/t23-,27?,28+,29?,30-/m0/s1 |
| InChIKey | UFTAMFIGZYPORI-IJWWJTLLSA-N |
| XLogP | 7.54 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|