C28H41F3N4O4 — CID 90352364
[(4S,5S)-3-[(2R,5S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-6-[(2S)-butan-2-yl]-4,5-dimethyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 90352364) has the molecular formula C28H41F3N4O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is [(4S,5S)-3-[(2R,5S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-6-[(2S)-butan-2-yl]-4,5-dimethyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(4S,5S)-3-[(2R,5S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-6-[(2S)-butan-2-yl]-4,5-dimethyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 90352364 |
| Molecular Formula | C28H41F3N4O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | [(4S,5S)-3-[(2R,5S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-6-[(2S)-butan-2-yl]-4,5-dimethyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | CCC1O[C@H](OC2C(O/C(=N/c3ccccc3)C(F)(F)F)OC([C@@H](C)CC)[C@@H](C)[C@@H]2C)C(N=[N+]=[N-])C(C)[C@@H]1C |
| InChI | InChI=1S/C28H41F3N4O4/c1-8-15(3)23-18(6)19(7)24(38-25-22(34-35-32)17(5)16(4)21(9-2)36-25)26(37-23)39-27(28(29,30)31)33-20-13-11-10-12-14-20/h10-19,21-26H,8-9H2,1-7H3/b33-27+/t15-,16-,17?,18-,19-,21?,22?,23?,24?,25+,26?/m0/s1 |
| InChIKey | LMDFKXAFJZTXBQ-GYZLCWJWSA-N |
| XLogP | 7.81 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|