C14H16F3NO6 — CID 134159414
[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 134159414) has the molecular formula C14H16F3NO6 and a molecular weight of 351.28 g/mol. Its IUPAC name is [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 134159414 |
| Molecular Formula | C14H16F3NO6 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | OC[C@H]1OC(O/C(=N/c2ccccc2)C(F)(F)F)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16F3NO6/c15-14(16,17)13(18-7-4-2-1-3-5-7)24-12-11(22)10(21)9(20)8(6-19)23-12/h1-5,8-12,19-22H,6H2/b18-13+/t8-,9-,10+,11+,12?/m1/s1 |
| InChIKey | YSACGUGUQMGVOG-XIKWFBJNSA-N |
| XLogP | 0.10 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|