C42H32F3NO10 — CID 56647477
[(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate (PubChem CID 56647477) has the molecular formula C42H32F3NO10 and a molecular weight of 767.71 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 56647477 |
| Molecular Formula | C42H32F3NO10 |
| Molecular Weight | 767.71 g/mol |
| Exact Mass | 767.20 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H32F3NO10/c43-42(44,45)41(46-31-24-14-5-15-25-31)56-40-35(55-39(50)30-22-12-4-13-23-30)34(54-38(49)29-20-10-3-11-21-29)33(53-37(48)28-18-8-2-9-19-28)32(52-40)26-51-36(47)27-16-6-1-7-17-27/h1-25,32-35,40H,26H2/b46-41+/t32-,33+,34+,35-,40+/m1/s1 |
| InChIKey | AMFLBZZPOOKETQ-RJYMLYPCSA-N |
| XLogP | 7.55 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|