C13H18Cl2O7 — CID 174926866
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] benzoate;dihydrochloride (PubChem CID 174926866) has the molecular formula C13H18Cl2O7 and a molecular weight of 357.19 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] benzoate;dihydrochloride.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] benzoate;dihydrochloride |
|---|---|
| PubChem CID | 174926866 |
| Molecular Formula | C13H18Cl2O7 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] benzoate;dihydrochloride |
| SMILES | Cl.Cl.O=C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C13H16O7.2ClH/c14-6-8-9(15)10(16)11(17)13(19-8)20-12(18)7-4-2-1-3-5-7;;/h1-5,8-11,13-17H,6H2;2*1H/t8-,9-,10+,11-,13+;;/m1../s1 |
| InChIKey | HDUNJJWZJOVHQH-ZVNZFUDFSA-N |
| XLogP | -0.51 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |