C12H14O7 — CID 174313829
[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] benzenecarboperoxoate (PubChem CID 174313829) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] benzenecarboperoxoate.
| Compound Name | [(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] benzenecarboperoxoate |
|---|---|
| PubChem CID | 174313829 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] benzenecarboperoxoate |
| SMILES | O=C(OO[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C12H14O7/c13-6-8-9(14)10(15)12(17-8)19-18-11(16)7-4-2-1-3-5-7/h1-5,8-10,12-15H,6H2/t8-,9-,10-,12+/m1/s1 |
| InChIKey | RCRCVSKHKUNTMV-BFLSOPEQSA-N |
| XLogP | -0.79 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|