C7H12O7 — CID 20743011
[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] ethaneperoxoate (PubChem CID 20743011) has the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] ethaneperoxoate.
| Compound Name | [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 20743011 |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] ethaneperoxoate |
| SMILES | CC(=O)OOC1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12O7/c1-3(9)13-14-7-6(11)5(10)4(2-8)12-7/h4-8,10-11H,2H2,1H3/t4-,5-,6-,7?/m1/s1 |
| InChIKey | MUNCUYSETYHTQM-RKEPMNIXSA-N |
| XLogP | -2.08 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|