C11H14O5 — CID 70003357
(2R,3S,4S)-2-(hydroxymethyl)-5-phenoxyoxolane-3,4-diol (PubChem CID 70003357) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)-5-phenoxyoxolane-3,4-diol.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)-5-phenoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 70003357 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)-5-phenoxyoxolane-3,4-diol |
| SMILES | OC[C@H]1OC(Oc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H14O5/c12-6-8-9(13)10(14)11(16-8)15-7-4-2-1-3-5-7/h1-5,8-14H,6H2/t8-,9-,10+,11?/m1/s1 |
| InChIKey | WZMSBIOCODYZPT-NFLHVTIKSA-N |
| XLogP | -0.50 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |