C12H15FO5 — CID 172642131
(3S,4R,6R)-5-fluoro-2-(hydroxymethyl)-6-phenoxyoxane-3,4-diol (PubChem CID 172642131) has the molecular formula C12H15FO5 and a molecular weight of 258.25 g/mol. Its IUPAC name is (3S,4R,6R)-5-fluoro-2-(hydroxymethyl)-6-phenoxyoxane-3,4-diol.
| Compound Name | (3S,4R,6R)-5-fluoro-2-(hydroxymethyl)-6-phenoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 172642131 |
| Molecular Formula | C12H15FO5 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (3S,4R,6R)-5-fluoro-2-(hydroxymethyl)-6-phenoxyoxane-3,4-diol |
| SMILES | OCC1O[C@H](Oc2ccccc2)C(F)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15FO5/c13-9-11(16)10(15)8(6-14)18-12(9)17-7-4-2-1-3-5-7/h1-5,8-12,14-16H,6H2/t8?,9?,10-,11+,12+/m1/s1 |
| InChIKey | UKCYOUIOUNQZTH-UFJRKFNTSA-N |
| XLogP | -0.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |