C12H15FO6 — CID 71182083
(2S,4S,5S)-2-(4-fluorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71182083) has the molecular formula C12H15FO6 and a molecular weight of 274.24 g/mol. Its IUPAC name is (2S,4S,5S)-2-(4-fluorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4S,5S)-2-(4-fluorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71182083 |
| Molecular Formula | C12H15FO6 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (2S,4S,5S)-2-(4-fluorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](Oc2ccc(F)cc2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15FO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5H2/t8?,9-,10+,11?,12-/m1/s1 |
| InChIKey | BWCHYPPTNWPJDG-RXUZKVILSA-N |
| XLogP | -1.00 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |