C12H15IO6 — CID 54360485
(2R,3R,4S,5R)-2-(hydroxymethyl)-6-(4-iodophenoxy)oxane-3,4,5-triol (PubChem CID 54360485) has the molecular formula C12H15IO6 and a molecular weight of 382.15 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(hydroxymethyl)-6-(4-iodophenoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-6-(4-iodophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54360485 |
| Molecular Formula | C12H15IO6 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-6-(4-iodophenoxy)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(Oc2ccc(I)cc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15IO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12?/m1/s1 |
| InChIKey | UMDHSEVUHJVYNA-SCWFEDMQSA-N |
| XLogP | -0.53 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|