C12H16O6 — CID 51340684
(4R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol (PubChem CID 51340684) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (4R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol.
| Compound Name | (4R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 51340684 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (4R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](Oc2ccccc2)C(O)[C@H](O)C1O |
| InChI | InChI=1S/C12H16O6/c13-6-8-9(14)10(15)11(16)12(18-8)17-7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8?,9?,10-,11?,12-/m1/s1 |
| InChIKey | NEZJDVYDSZTRFS-NPLYTMANSA-N |
| XLogP | -1.13 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |