C20H29NO11 — CID 70170998
acetonitrile;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 70170998) has the molecular formula C20H29NO11 and a molecular weight of 459.45 g/mol. Its IUPAC name is acetonitrile;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | acetonitrile;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70170998 |
| Molecular Formula | C20H29NO11 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | acetonitrile;(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CC#N.OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3ccccc3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26O11.C2H3N/c19-6-9-11(20)13(22)15(24)17(28-9)26-7-10-12(21)14(23)16(25)18(29-10)27-8-4-2-1-3-5-8;1-2-3/h1-5,9-25H,6-7H2;1H3/t9-,10-,11-,12-,13+,14+,15-,16-,17-,18-;/m1./s1 |
| InChIKey | FSGOVMZMRGLIEX-IRHVIGOISA-N |
| XLogP | -2.78 |
| TPSA | 202.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |