C24H24O5 — CID 54540379
(2R,3S,4R)-2-(hydroxymethyl)-5-trityloxyoxolane-3,4-diol (PubChem CID 54540379) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-trityloxyoxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-trityloxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 54540379 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-trityloxyoxolane-3,4-diol |
| SMILES | OC[C@H]1OC(OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24O5/c25-16-20-21(26)22(27)23(28-20)29-24(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-23,25-27H,16H2/t20-,21-,22-,23?/m1/s1 |
| InChIKey | ZCTJYSPNBKQVIV-YRNFEDNZSA-N |
| XLogP | 2.43 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|