C18H21O6P — CID 67777099
(2R,3R,4S,5S,6R)-2-diphenylphosphanyloxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 67777099) has the molecular formula C18H21O6P and a molecular weight of 364.33 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-diphenylphosphanyloxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-diphenylphosphanyloxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67777099 |
| Molecular Formula | C18H21O6P |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-diphenylphosphanyloxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](OP(c2ccccc2)c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21O6P/c19-11-14-15(20)16(21)17(22)18(23-14)24-25(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-22H,11H2/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | YNRWIXYJDPFKNM-UYTYNIKBSA-N |
| XLogP | -0.15 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|