C30H30O6P2 — CID 87601756
(2R,3R,4S,5R,6R)-3,4-bis(diphenylphosphanyloxy)-6-(hydroxymethyl)oxane-2,5-diol (PubChem CID 87601756) has the molecular formula C30H30O6P2 and a molecular weight of 548.51 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3,4-bis(diphenylphosphanyloxy)-6-(hydroxymethyl)oxane-2,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-3,4-bis(diphenylphosphanyloxy)-6-(hydroxymethyl)oxane-2,5-diol |
|---|---|
| PubChem CID | 87601756 |
| Molecular Formula | C30H30O6P2 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3,4-bis(diphenylphosphanyloxy)-6-(hydroxymethyl)oxane-2,5-diol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](OP(c2ccccc2)c2ccccc2)[C@@H](OP(c2ccccc2)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C30H30O6P2/c31-21-26-27(32)28(35-37(22-13-5-1-6-14-22)23-15-7-2-8-16-23)29(30(33)34-26)36-38(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20,26-33H,21H2/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | XNFVZZXVKXXMCY-CMPUJJQDSA-N |
| XLogP | 2.92 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|