C16H20O6 — CID 68554455
(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;naphthalene (PubChem CID 68554455) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;naphthalene.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;naphthalene |
|---|---|
| PubChem CID | 68554455 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;naphthalene |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H12O6/c1-2-6-10-8-4-3-7-9(10)5-1;7-1-2-3(8)4(9)5(10)6(11)12-2/h1-8H;2-11H,1H2/t;2-,3-,4+,5-,6?/m.1/s1 |
| InChIKey | AVYCYWWZAXGQSC-MSPHXDAXSA-N |
| XLogP | -0.38 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |