C11H16O7 — CID 118064590
benzene-1,2-diol;(2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol (PubChem CID 118064590) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is benzene-1,2-diol;(2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol.
| Compound Name | benzene-1,2-diol;(2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 118064590 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | benzene-1,2-diol;(2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C5H10O5/c7-5-3-1-2-4-6(5)8;6-1-2-3(7)4(8)5(9)10-2/h1-4,7-8H;2-9H,1H2/t;2-,3-,4-,5-/m.1/s1 |
| InChIKey | QNSLQSWAIXMSNH-CAXHYWHXSA-N |
| XLogP | -1.48 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|