C12H16O7 — CID 67748323
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxyphenoxy)oxane-2,4,5-triol (PubChem CID 67748323) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxyphenoxy)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxyphenoxy)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 67748323 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxyphenoxy)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](Oc2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(12(17)19-8)18-7-4-2-1-3-6(7)14/h1-4,8-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | PVTMSOOHGWGHDV-YBXAARCKSA-N |
| XLogP | -1.43 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |