C17H20O7 — CID 67827682
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-methoxynaphthalen-1-yl)oxyoxane-2,4,5-triol (PubChem CID 67827682) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-methoxynaphthalen-1-yl)oxyoxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-methoxynaphthalen-1-yl)oxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 67827682 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-methoxynaphthalen-1-yl)oxyoxane-2,4,5-triol |
| SMILES | COc1ccc2ccccc2c1O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C17H20O7/c1-22-11-7-6-9-4-2-3-5-10(9)15(11)24-16-14(20)13(19)12(8-18)23-17(16)21/h2-7,12-14,16-21H,8H2,1H3/t12-,13+,14+,16-,17-/m1/s1 |
| InChIKey | XYPVPKZGEYFCND-NJNCZSALSA-N |
| XLogP | 0.03 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |